C18H26N4O3 — CID 167806740
8-cyclopentyl-7-[(Z)-4-methoxy-3-methylbut-2-enyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 167806740) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 8-cyclopentyl-7-[(Z)-4-methoxy-3-methylbut-2-enyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-cyclopentyl-7-[(Z)-4-methoxy-3-methylbut-2-enyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 167806740 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 8-cyclopentyl-7-[(Z)-4-methoxy-3-methylbut-2-enyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | COC/C(C)=C\Cn1c(C2CCCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H26N4O3/c1-12(11-25-4)9-10-22-14-16(19-15(22)13-7-5-6-8-13)20(2)18(24)21(3)17(14)23/h9,13H,5-8,10-11H2,1-4H3/b12-9- |
| InChIKey | VOWXMHDFOYEJPD-XFXZXTDPSA-N |
| XLogP | 1.68 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|