C17H25N5O3 — CID 73356668
1,3-dimethyl-7-(3-methylbut-2-enyl)-8-piperidin-4-yloxypurine-2,6-dione (PubChem CID 73356668) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-piperidin-4-yloxypurine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-piperidin-4-yloxypurine-2,6-dione |
|---|---|
| PubChem CID | 73356668 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-piperidin-4-yloxypurine-2,6-dione |
| SMILES | CC(C)=CCn1c(OC2CCNCC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H25N5O3/c1-11(2)7-10-22-13-14(20(3)17(24)21(4)15(13)23)19-16(22)25-12-5-8-18-9-6-12/h7,12,18H,5-6,8-10H2,1-4H3 |
| InChIKey | DHNVLBNWKVLFKX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|