C17H24N6O4 — CID 152678385
1,3-dimethyl-7-(3-methylbut-2-enyl)-8-(1-nitropiperidin-4-yl)purine-2,6-dione (PubChem CID 152678385) has the molecular formula C17H24N6O4 and a molecular weight of 376.42 g/mol. Its IUPAC name is 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-(1-nitropiperidin-4-yl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-(1-nitropiperidin-4-yl)purine-2,6-dione |
|---|---|
| PubChem CID | 152678385 |
| Molecular Formula | C17H24N6O4 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1,3-dimethyl-7-(3-methylbut-2-enyl)-8-(1-nitropiperidin-4-yl)purine-2,6-dione |
| SMILES | CC(C)=CCn1c(C2CCN([N+](=O)[O-])CC2)nc2c1c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H24N6O4/c1-11(2)5-10-22-13-15(19(3)17(25)20(4)16(13)24)18-14(22)12-6-8-21(9-7-12)23(26)27/h5,12H,6-10H2,1-4H3 |
| InChIKey | ZMZQDJKMRGRBEI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 108.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|