2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid

C12H14N4O4 — CID 118975757

IUPAC2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid
SMILESCn1c(=O)c2c(nc(C3CC3)n2CC(=O)O)n(C)c1=O
InChIInChI=1S/C12H14N4O4/c1-14-10-8(11(19)15(2)12(14)20)16(5-7(17)18)9(13-10)6-3-4-6/h6H,3-5H2,1-2H3,(H,17,18)
InChIKeyZZYOYLFXAVFIMO-UHFFFAOYSA-N
MW278.27 g/mol
LogP-0.60
Rot. Bonds3

About 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid

2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid (PubChem CID 118975757) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid.

Molecular Properties

Compound Name2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid
PubChem CID118975757
Molecular FormulaC12H14N4O4
Molecular Weight278.27 g/mol
Exact Mass278.10
IUPAC Name2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid
SMILESCn1c(=O)c2c(nc(C3CC3)n2CC(=O)O)n(C)c1=O
InChIInChI=1S/C12H14N4O4/c1-14-10-8(11(19)15(2)12(14)20)16(5-7(17)18)9(13-10)6-3-4-6/h6H,3-5H2,1-2H3,(H,17,18)
InChIKeyZZYOYLFXAVFIMO-UHFFFAOYSA-N
XLogP-0.60
TPSA99.12 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.27
LogP ≤ 5-0.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid?
The IUPAC name of 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid (CID 118975757) is 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid.
What is the SMILES notation for 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid?
The canonical SMILES for 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid is Cn1c(=O)c2c(nc(C3CC3)n2CC(=O)O)n(C)c1=O.
What is the InChIKey of 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid?
The InChIKey is ZZYOYLFXAVFIMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O4/c1-14-10-8(11(19)15(2)12(14)20)16(5-7(17)18)9(13-10)6-3-4-6/h6H,3-5H2,1-2H3,(H,17,18).
What are the key properties of 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid?
2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid has a molecular weight of 278.27 g/mol, XLogP of -0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid is sourced from PubChem (CID 118975757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).