C12H14N4O4 — CID 118975757
2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid (PubChem CID 118975757) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid.
| Compound Name | 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid |
|---|---|
| PubChem CID | 118975757 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2-(8-cyclopropyl-1,3-dimethyl-2,6-dioxopurin-7-yl)acetic acid |
| SMILES | Cn1c(=O)c2c(nc(C3CC3)n2CC(=O)O)n(C)c1=O |
| InChI | InChI=1S/C12H14N4O4/c1-14-10-8(11(19)15(2)12(14)20)16(5-7(17)18)9(13-10)6-3-4-6/h6H,3-5H2,1-2H3,(H,17,18) |
| InChIKey | ZZYOYLFXAVFIMO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |