C19H28N4O2 — CID 154715805
7,8-dicyclohexyl-1,3-dimethylpurine-2,6-dione (PubChem CID 154715805) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 7,8-dicyclohexyl-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7,8-dicyclohexyl-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 154715805 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 7,8-dicyclohexyl-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(C3CCCCC3)n2C2CCCCC2)n(C)c1=O |
| InChI | InChI=1S/C19H28N4O2/c1-21-17-15(18(24)22(2)19(21)25)23(14-11-7-4-8-12-14)16(20-17)13-9-5-3-6-10-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | PLUNYMCTNOFBER-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |