C15H23N5O2 — CID 82465215
8-(2-aminoethyl)-3-cyclohexyl-1,7-dimethylpurine-2,6-dione (PubChem CID 82465215) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 8-(2-aminoethyl)-3-cyclohexyl-1,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-aminoethyl)-3-cyclohexyl-1,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 82465215 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 8-(2-aminoethyl)-3-cyclohexyl-1,7-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(CCN)n2C)n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C15H23N5O2/c1-18-11(8-9-16)17-13-12(18)14(21)19(2)15(22)20(13)10-6-4-3-5-7-10/h10H,3-9,16H2,1-2H3 |
| InChIKey | FGIYUIUPOGAEAG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |