C13H19N5O2 — CID 82464302
8-(aminomethyl)-3-cyclohexyl-7-methylpurine-2,6-dione (PubChem CID 82464302) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 8-(aminomethyl)-3-cyclohexyl-7-methylpurine-2,6-dione.
| Compound Name | 8-(aminomethyl)-3-cyclohexyl-7-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 82464302 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 8-(aminomethyl)-3-cyclohexyl-7-methylpurine-2,6-dione |
| SMILES | Cn1c(CN)nc2c1c(=O)[nH]c(=O)n2C1CCCCC1 |
| InChI | InChI=1S/C13H19N5O2/c1-17-9(7-14)15-11-10(17)12(19)16-13(20)18(11)8-5-3-2-4-6-8/h8H,2-7,14H2,1H3,(H,16,19,20) |
| InChIKey | MYOWDGMPTYPMBE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |