C14H21N5O3 — CID 82466184
8-(methoxymethyl)-3,7-dimethyl-1-piperidin-4-ylpurine-2,6-dione (PubChem CID 82466184) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 8-(methoxymethyl)-3,7-dimethyl-1-piperidin-4-ylpurine-2,6-dione.
| Compound Name | 8-(methoxymethyl)-3,7-dimethyl-1-piperidin-4-ylpurine-2,6-dione |
|---|---|
| PubChem CID | 82466184 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 8-(methoxymethyl)-3,7-dimethyl-1-piperidin-4-ylpurine-2,6-dione |
| SMILES | COCc1nc2c(c(=O)n(C3CCNCC3)c(=O)n2C)n1C |
| InChI | InChI=1S/C14H21N5O3/c1-17-10(8-22-3)16-12-11(17)13(20)19(14(21)18(12)2)9-4-6-15-7-5-9/h9,15H,4-8H2,1-3H3 |
| InChIKey | CGGZGLOVDOFDMX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |