C15H19N3O2 — CID 117263130
1,8-dimethyl-3-piperidin-4-ylquinazoline-2,4-dione (PubChem CID 117263130) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 1,8-dimethyl-3-piperidin-4-ylquinazoline-2,4-dione.
| Compound Name | 1,8-dimethyl-3-piperidin-4-ylquinazoline-2,4-dione |
|---|---|
| PubChem CID | 117263130 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1,8-dimethyl-3-piperidin-4-ylquinazoline-2,4-dione |
| SMILES | Cc1cccc2c(=O)n(C3CCNCC3)c(=O)n(C)c12 |
| InChI | InChI=1S/C15H19N3O2/c1-10-4-3-5-12-13(10)17(2)15(20)18(14(12)19)11-6-8-16-9-7-11/h3-5,11,16H,6-9H2,1-2H3 |
| InChIKey | FMJCPGYHEPQPRN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |