C16H21N3O2 — CID 117263187
1,8-dimethyl-3-(piperidin-2-ylmethyl)quinazoline-2,4-dione (PubChem CID 117263187) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1,8-dimethyl-3-(piperidin-2-ylmethyl)quinazoline-2,4-dione.
| Compound Name | 1,8-dimethyl-3-(piperidin-2-ylmethyl)quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117263187 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1,8-dimethyl-3-(piperidin-2-ylmethyl)quinazoline-2,4-dione |
| SMILES | Cc1cccc2c(=O)n(CC3CCCCN3)c(=O)n(C)c12 |
| InChI | InChI=1S/C16H21N3O2/c1-11-6-5-8-13-14(11)18(2)16(21)19(15(13)20)10-12-7-3-4-9-17-12/h5-6,8,12,17H,3-4,7,9-10H2,1-2H3 |
| InChIKey | RBXUBCNDEXSXFL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |