C14H21N5O2 — CID 82466277
7-methyl-3-propyl-1-(pyrrolidin-2-ylmethyl)purine-2,6-dione (PubChem CID 82466277) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 7-methyl-3-propyl-1-(pyrrolidin-2-ylmethyl)purine-2,6-dione.
| Compound Name | 7-methyl-3-propyl-1-(pyrrolidin-2-ylmethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 82466277 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 7-methyl-3-propyl-1-(pyrrolidin-2-ylmethyl)purine-2,6-dione |
| SMILES | CCCn1c(=O)n(CC2CCCN2)c(=O)c2c1ncn2C |
| InChI | InChI=1S/C14H21N5O2/c1-3-7-18-12-11(17(2)9-16-12)13(20)19(14(18)21)8-10-5-4-6-15-10/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | NVKYQZKMHZDBHQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |