C12H18N6O2 — CID 82465201
3-cyclohexyl-8-hydrazinyl-1-methyl-7H-purine-2,6-dione (PubChem CID 82465201) has the molecular formula C12H18N6O2 and a molecular weight of 278.32 g/mol. Its IUPAC name is 3-cyclohexyl-8-hydrazinyl-1-methyl-7H-purine-2,6-dione.
| Compound Name | 3-cyclohexyl-8-hydrazinyl-1-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 82465201 |
| Molecular Formula | C12H18N6O2 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-cyclohexyl-8-hydrazinyl-1-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(NN)nc2n(C2CCCCC2)c1=O |
| InChI | InChI=1S/C12H18N6O2/c1-17-10(19)8-9(15-11(14-8)16-13)18(12(17)20)7-5-3-2-4-6-7/h7H,2-6,13H2,1H3,(H2,14,15,16) |
| InChIKey | PKAAALOJRLHONM-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|