C34H46Cl2N8O4 — CID 158695416
8-chloro-1,3-dicyclohexyl-7H-purine-2,6-dione (PubChem CID 158695416) has the molecular formula C34H46Cl2N8O4 and a molecular weight of 701.70 g/mol. Its IUPAC name is 8-chloro-1,3-dicyclohexyl-7H-purine-2,6-dione.
| Compound Name | 8-chloro-1,3-dicyclohexyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 158695416 |
| Molecular Formula | C34H46Cl2N8O4 |
| Molecular Weight | 701.70 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 8-chloro-1,3-dicyclohexyl-7H-purine-2,6-dione |
| SMILES | O=c1c2[nH]c(Cl)nc2n(C2CCCCC2)c(=O)n1C1CCCCC1.O=c1c2[nH]c(Cl)nc2n(C2CCCCC2)c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/2C17H23ClN4O2/c2*18-16-19-13-14(20-16)21(11-7-3-1-4-8-11)17(24)22(15(13)23)12-9-5-2-6-10-12/h2*11-12H,1-10H2,(H,19,20) |
| InChIKey | IGWLYMZAWZNGIM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 145.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.70 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |