C16H16ClN5O2 — CID 163450683
8-(6-chloro-2-methyl-3-pyridinyl)-3-cyclobutyl-1-methyl-7H-purine-2,6-dione (PubChem CID 163450683) has the molecular formula C16H16ClN5O2 and a molecular weight of 345.79 g/mol. Its IUPAC name is 8-(6-chloro-2-methyl-3-pyridinyl)-3-cyclobutyl-1-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(6-chloro-2-methyl-3-pyridinyl)-3-cyclobutyl-1-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 163450683 |
| Molecular Formula | C16H16ClN5O2 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 8-(6-chloro-2-methyl-3-pyridinyl)-3-cyclobutyl-1-methyl-7H-purine-2,6-dione |
| SMILES | Cc1nc(Cl)ccc1-c1nc2c([nH]1)c(=O)n(C)c(=O)n2C1CCC1 |
| InChI | InChI=1S/C16H16ClN5O2/c1-8-10(6-7-11(17)18-8)13-19-12-14(20-13)22(9-4-3-5-9)16(24)21(2)15(12)23/h6-7,9H,3-5H2,1-2H3,(H,19,20) |
| InChIKey | BGIJFBKOXWADNY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|