C17H20ClN5O2 — CID 10904528
8-(2-amino-5-chlorophenyl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 10904528) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is 8-(2-amino-5-chlorophenyl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-amino-5-chlorophenyl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 10904528 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 8-(2-amino-5-chlorophenyl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cc(Cl)ccc3N)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H20ClN5O2/c1-3-7-22-15-13(16(24)23(8-4-2)17(22)25)20-14(21-15)11-9-10(18)5-6-12(11)19/h5-6,9H,3-4,7-8,19H2,1-2H3,(H,20,21) |
| InChIKey | OIMCHAJYZJJSOS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|