C17H24N6O2 — CID 135489505
8-(2-ethyl-5-methylpyrazol-3-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 135489505) has the molecular formula C17H24N6O2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 8-(2-ethyl-5-methylpyrazol-3-yl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-ethyl-5-methylpyrazol-3-yl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 135489505 |
| Molecular Formula | C17H24N6O2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 8-(2-ethyl-5-methylpyrazol-3-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cc(C)nn3CC)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H24N6O2/c1-5-8-21-15-13(16(24)22(9-6-2)17(21)25)18-14(19-15)12-10-11(4)20-23(12)7-3/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | XMBZQKGOUSKEJS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |