C24H36N8O5 — CID 135529381
tert-butyl N-[4-[[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-methylpyrazol-3-yl]amino]-4-oxobutyl]carbamate (PubChem CID 135529381) has the molecular formula C24H36N8O5 and a molecular weight of 516.60 g/mol. Its IUPAC name is tert-butyl N-[4-[[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-methylpyrazol-3-yl]amino]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-methylpyrazol-3-yl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 135529381 |
| Molecular Formula | C24H36N8O5 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | tert-butyl N-[4-[[5-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-1-methylpyrazol-3-yl]amino]-4-oxobutyl]carbamate |
| SMILES | CCCn1c(=O)c2[nH]c(-c3cc(NC(=O)CCCNC(=O)OC(C)(C)C)nn3C)nc2n(CCC)c1=O |
| InChI | InChI=1S/C24H36N8O5/c1-7-12-31-20-18(21(34)32(13-8-2)23(31)36)27-19(28-20)15-14-16(29-30(15)6)26-17(33)10-9-11-25-22(35)37-24(3,4)5/h14H,7-13H2,1-6H3,(H,25,35)(H,27,28)(H,26,29,33) |
| InChIKey | JPZIWZQIYGHXLH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 157.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|