C27H44N6O4 — CID 18173066
tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methylamino]ethyl]carbamate (PubChem CID 18173066) has the molecular formula C27H44N6O4 and a molecular weight of 516.69 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 18173066 |
| Molecular Formula | C27H44N6O4 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methylamino]ethyl]carbamate |
| SMILES | CCCn1c(=O)c2[nH]c(C3CC4CCC(C3)C4CNCCNC(=O)OC(C)(C)C)nc2n(CCC)c1=O |
| InChI | InChI=1S/C27H44N6O4/c1-6-12-32-23-21(24(34)33(13-7-2)26(32)36)30-22(31-23)19-14-17-8-9-18(15-19)20(17)16-28-10-11-29-25(35)37-27(3,4)5/h17-20,28H,6-16H2,1-5H3,(H,29,35)(H,30,31) |
| InChIKey | VTUHZRODOJHROU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|