C26H42N6O4 — CID 69267701
tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]amino]ethyl]carbamate (PubChem CID 69267701) has the molecular formula C26H42N6O4 and a molecular weight of 502.66 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 69267701 |
| Molecular Formula | C26H42N6O4 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | tert-butyl N-[2-[[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]amino]ethyl]carbamate |
| SMILES | CCCn1c(=O)c2[nH]c(C3CC4CCC(C3)C4NCCNC(=O)OC(C)(C)C)nc2n(CCC)c1=O |
| InChI | InChI=1S/C26H42N6O4/c1-6-12-31-22-20(23(33)32(13-7-2)25(31)35)29-21(30-22)18-14-16-8-9-17(15-18)19(16)27-10-11-28-24(34)36-26(3,4)5/h16-19,27H,6-15H2,1-5H3,(H,28,34)(H,29,30) |
| InChIKey | SFSNMSQYKPBZRR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|