C17H26N4O5S — CID 57088174
1-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)-4-hydroxybutane-2-sulfinic acid (PubChem CID 57088174) has the molecular formula C17H26N4O5S and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)-4-hydroxybutane-2-sulfinic acid.
| Compound Name | 1-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)-4-hydroxybutane-2-sulfinic acid |
|---|---|
| PubChem CID | 57088174 |
| Molecular Formula | C17H26N4O5S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-(8-cyclopentyl-2,6-dioxo-1-propyl-7H-purin-3-yl)-4-hydroxybutane-2-sulfinic acid |
| SMILES | CCCn1c(=O)c2[nH]c(C3CCCC3)nc2n(CC(CCO)S(=O)O)c1=O |
| InChI | InChI=1S/C17H26N4O5S/c1-2-8-20-16(23)13-15(19-14(18-13)11-5-3-4-6-11)21(17(20)24)10-12(7-9-22)27(25)26/h11-12,22H,2-10H2,1H3,(H,18,19)(H,25,26) |
| InChIKey | BKCXJSCZYBSUAD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|