C19H26N6O — CID 18382489
2,7-dicyclopentyl-4-propyl-6H-[1,2,4]triazolo[5,1-b]purin-5-one (PubChem CID 18382489) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 2,7-dicyclopentyl-4-propyl-6H-[1,2,4]triazolo[5,1-b]purin-5-one.
| Compound Name | 2,7-dicyclopentyl-4-propyl-6H-[1,2,4]triazolo[5,1-b]purin-5-one |
|---|---|
| PubChem CID | 18382489 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2,7-dicyclopentyl-4-propyl-6H-[1,2,4]triazolo[5,1-b]purin-5-one |
| SMILES | CCCn1c(=O)c2[nH]c(C3CCCC3)nc2n2nc(C3CCCC3)nc12 |
| InChI | InChI=1S/C19H26N6O/c1-2-11-24-18(26)14-17(21-15(20-14)12-7-3-4-8-12)25-19(24)22-16(23-25)13-9-5-6-10-13/h12-13H,2-11H2,1H3,(H,20,21) |
| InChIKey | SAIZMOKFZKRMNU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |