C22H28N4O2 — CID 10022684
8-[(1S,2S)-2-phenylcyclopentyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 10022684) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 8-[(1S,2S)-2-phenylcyclopentyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[(1S,2S)-2-phenylcyclopentyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 10022684 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 8-[(1S,2S)-2-phenylcyclopentyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c([C@H]3CCC[C@@H]3c3ccccc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C22H28N4O2/c1-3-13-25-20-18(21(27)26(14-4-2)22(25)28)23-19(24-20)17-12-8-11-16(17)15-9-6-5-7-10-15/h5-7,9-10,16-17H,3-4,8,11-14H2,1-2H3,(H,23,24)/t16-,17+/m1/s1 |
| InChIKey | YVSLCJDYNIHYIX-SJORKVTESA-N |
| XLogP | 3.76 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |