C20H25N4O5P — CID 174160011
4-[1-ethyl-2,6-dioxo-8-(2-phenylcyclopropyl)-7H-purin-3-yl]butylphosphonic acid (PubChem CID 174160011) has the molecular formula C20H25N4O5P and a molecular weight of 432.42 g/mol. Its IUPAC name is 4-[1-ethyl-2,6-dioxo-8-(2-phenylcyclopropyl)-7H-purin-3-yl]butylphosphonic acid.
| Compound Name | 4-[1-ethyl-2,6-dioxo-8-(2-phenylcyclopropyl)-7H-purin-3-yl]butylphosphonic acid |
|---|---|
| PubChem CID | 174160011 |
| Molecular Formula | C20H25N4O5P |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | 4-[1-ethyl-2,6-dioxo-8-(2-phenylcyclopropyl)-7H-purin-3-yl]butylphosphonic acid |
| SMILES | CCn1c(=O)c2[nH]c(C3CC3c3ccccc3)nc2n(CCCCP(=O)(O)O)c1=O |
| InChI | InChI=1S/C20H25N4O5P/c1-2-23-19(25)16-18(24(20(23)26)10-6-7-11-30(27,28)29)22-17(21-16)15-12-14(15)13-8-4-3-5-9-13/h3-5,8-9,14-15H,2,6-7,10-12H2,1H3,(H,21,22)(H2,27,28,29) |
| InChIKey | VKWDZDBJZLEGGC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|