C18H24N4O2 — CID 57074385
8-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 57074385) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 8-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 57074385 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 8-[(1S,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c([C@@H]3C[C@@H]4C=C[C@@H]3C4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C18H24N4O2/c1-3-7-21-16-14(17(23)22(8-4-2)18(21)24)19-15(20-16)13-10-11-5-6-12(13)9-11/h5-6,11-13H,3-4,7-10H2,1-2H3,(H,19,20)/t11-,12-,13-/m1/s1 |
| InChIKey | LMZOGRHOEMOQIR-JHJVBQTASA-N |
| XLogP | 2.39 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|