C23H32N4O4 — CID 67813083
8-(8,8-dimethyl-6,10-dioxospiro[4.5]decan-3-yl)-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 67813083) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 8-(8,8-dimethyl-6,10-dioxospiro[4.5]decan-3-yl)-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-(8,8-dimethyl-6,10-dioxospiro[4.5]decan-3-yl)-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 67813083 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 8-(8,8-dimethyl-6,10-dioxospiro[4.5]decan-3-yl)-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c(C3CCC4(C3)C(=O)CC(C)(C)CC4=O)nc2n(CCC)c1=O |
| InChI | InChI=1S/C23H32N4O4/c1-5-9-26-19-17(20(30)27(10-6-2)21(26)31)24-18(25-19)14-7-8-23(11-14)15(28)12-22(3,4)13-16(23)29/h14H,5-13H2,1-4H3,(H,24,25) |
| InChIKey | FJQOYTJTWDCACU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 106.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|