C17H24N4O3 — CID 11551701
8-[(6R)-2-oxabicyclo[2.2.1]heptan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione (PubChem CID 11551701) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is 8-[(6R)-2-oxabicyclo[2.2.1]heptan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione.
| Compound Name | 8-[(6R)-2-oxabicyclo[2.2.1]heptan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 11551701 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 8-[(6R)-2-oxabicyclo[2.2.1]heptan-6-yl]-1,3-dipropyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]c([C@H]3CC4COC3C4)nc2n(CCC)c1=O |
| InChI | InChI=1S/C17H24N4O3/c1-3-5-20-15-13(16(22)21(6-4-2)17(20)23)18-14(19-15)11-7-10-8-12(11)24-9-10/h10-12H,3-9H2,1-2H3,(H,18,19)/t10?,11-,12?/m0/s1 |
| InChIKey | ZDFLXHLWMSBMLB-CXQJBGSLSA-N |
| XLogP | 1.60 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |