C26H40N7O2+ — CID 18173078
[3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methyl-(3-imidazol-1-ylpropyl)azanium (PubChem CID 18173078) has the molecular formula C26H40N7O2+ and a molecular weight of 482.65 g/mol. Its IUPAC name is [3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methyl-(3-imidazol-1-ylpropyl)azanium.
| Compound Name | [3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methyl-(3-imidazol-1-ylpropyl)azanium |
|---|---|
| PubChem CID | 18173078 |
| Molecular Formula | C26H40N7O2+ |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | [3-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)-8-bicyclo[3.2.1]octanyl]methyl-(3-imidazol-1-ylpropyl)azanium |
| SMILES | CCCn1c(=O)c2[nH]c(C3CC4CCC(C3)C4C[NH2+]CCCn3ccnc3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C26H39N7O2/c1-3-10-32-24-22(25(34)33(11-4-2)26(32)35)29-23(30-24)20-14-18-6-7-19(15-20)21(18)16-27-8-5-12-31-13-9-28-17-31/h9,13,17-21,27H,3-8,10-12,14-16H2,1-2H3,(H,29,30)/p+1 |
| InChIKey | XWQXBZTZVMHYFI-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|