C18H21N5O4S — CID 91948279
8-[1-(benzenesulfonyl)piperidin-3-yl]-1,3-dimethyl-7H-purine-2,6-dione (PubChem CID 91948279) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is 8-[1-(benzenesulfonyl)piperidin-3-yl]-1,3-dimethyl-7H-purine-2,6-dione.
| Compound Name | 8-[1-(benzenesulfonyl)piperidin-3-yl]-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 91948279 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 8-[1-(benzenesulfonyl)piperidin-3-yl]-1,3-dimethyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)c2[nH]c(C3CCCN(S(=O)(=O)c4ccccc4)C3)nc2n(C)c1=O |
| InChI | InChI=1S/C18H21N5O4S/c1-21-16-14(17(24)22(2)18(21)25)19-15(20-16)12-7-6-10-23(11-12)28(26,27)13-8-4-3-5-9-13/h3-5,8-9,12H,6-7,10-11H2,1-2H3,(H,19,20) |
| InChIKey | AZAMGQQAAMFKJO-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |