C17H18N4O2S — CID 110118652
6-[1-(benzenesulfonyl)piperidin-3-yl]-1H-pyrazolo[5,4-b]pyridine (PubChem CID 110118652) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 6-[1-(benzenesulfonyl)piperidin-3-yl]-1H-pyrazolo[5,4-b]pyridine.
| Compound Name | 6-[1-(benzenesulfonyl)piperidin-3-yl]-1H-pyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 110118652 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 6-[1-(benzenesulfonyl)piperidin-3-yl]-1H-pyrazolo[5,4-b]pyridine |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC(c2ccc3cn[nH]c3n2)C1 |
| InChI | InChI=1S/C17H18N4O2S/c22-24(23,15-6-2-1-3-7-15)21-10-4-5-14(12-21)16-9-8-13-11-18-20-17(13)19-16/h1-3,6-9,11,14H,4-5,10,12H2,(H,18,19,20) |
| InChIKey | ONFXVYBFINRNQV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |