C16H18FN3O2S — CID 125006109
4-[(3R)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-2-methylpyrimidine (PubChem CID 125006109) has the molecular formula C16H18FN3O2S and a molecular weight of 335.40 g/mol. Its IUPAC name is 4-[(3R)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-2-methylpyrimidine.
| Compound Name | 4-[(3R)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 125006109 |
| Molecular Formula | C16H18FN3O2S |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-[(3R)-1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-2-methylpyrimidine |
| SMILES | Cc1nccc([C@@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C16H18FN3O2S/c1-12-18-9-8-16(19-12)13-3-2-10-20(11-13)23(21,22)15-6-4-14(17)5-7-15/h4-9,13H,2-3,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | UDUDHPQZGRMGEU-CYBMUJFWSA-N |
| XLogP | 2.49 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |