C15H18FN3O2S — CID 124953145
(3R)-1-(4-fluorophenyl)sulfonyl-3-(5-methyl-1H-imidazol-2-yl)piperidine (PubChem CID 124953145) has the molecular formula C15H18FN3O2S and a molecular weight of 323.39 g/mol. Its IUPAC name is (3R)-1-(4-fluorophenyl)sulfonyl-3-(5-methyl-1H-imidazol-2-yl)piperidine.
| Compound Name | (3R)-1-(4-fluorophenyl)sulfonyl-3-(5-methyl-1H-imidazol-2-yl)piperidine |
|---|---|
| PubChem CID | 124953145 |
| Molecular Formula | C15H18FN3O2S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | (3R)-1-(4-fluorophenyl)sulfonyl-3-(5-methyl-1H-imidazol-2-yl)piperidine |
| SMILES | Cc1cnc([C@@H]2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)[nH]1 |
| InChI | InChI=1S/C15H18FN3O2S/c1-11-9-17-15(18-11)12-3-2-8-19(10-12)22(20,21)14-6-4-13(16)5-7-14/h4-7,9,12H,2-3,8,10H2,1H3,(H,17,18)/t12-/m1/s1 |
| InChIKey | DTLVIXFZNQRGLO-GFCCVEGCSA-N |
| XLogP | 2.43 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |