C14H15F2N3O2S — CID 110104922
2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]-5-methyl-1H-imidazole (PubChem CID 110104922) has the molecular formula C14H15F2N3O2S and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]-5-methyl-1H-imidazole.
| Compound Name | 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]-5-methyl-1H-imidazole |
|---|---|
| PubChem CID | 110104922 |
| Molecular Formula | C14H15F2N3O2S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[1-(3,4-difluorophenyl)sulfonylpyrrolidin-3-yl]-5-methyl-1H-imidazole |
| SMILES | Cc1cnc(C2CCN(S(=O)(=O)c3ccc(F)c(F)c3)C2)[nH]1 |
| InChI | InChI=1S/C14H15F2N3O2S/c1-9-7-17-14(18-9)10-4-5-19(8-10)22(20,21)11-2-3-12(15)13(16)6-11/h2-3,6-7,10H,4-5,8H2,1H3,(H,17,18) |
| InChIKey | MBVOQSKBQODMLZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |