C14H14F2N2O2S2 — CID 124562567
2-[(3R)-1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1,3-thiazole (PubChem CID 124562567) has the molecular formula C14H14F2N2O2S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1,3-thiazole.
| Compound Name | 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 124562567 |
| Molecular Formula | C14H14F2N2O2S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-[(3R)-1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1,3-thiazole |
| SMILES | O=S(=O)(c1ccc(F)c(F)c1)N1CCC[C@@H](c2nccs2)C1 |
| InChI | InChI=1S/C14H14F2N2O2S2/c15-12-4-3-11(8-13(12)16)22(19,20)18-6-1-2-10(9-18)14-17-5-7-21-14/h3-5,7-8,10H,1-2,6,9H2/t10-/m1/s1 |
| InChIKey | NBSZBMJYFTZHRZ-SNVBAGLBSA-N |
| XLogP | 2.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |