C15H15F2N3O3S — CID 110115186
6-[1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one (PubChem CID 110115186) has the molecular formula C15H15F2N3O3S and a molecular weight of 355.37 g/mol. Its IUPAC name is 6-[1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-[1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 110115186 |
| Molecular Formula | C15H15F2N3O3S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-[1-(3,4-difluorophenyl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one |
| SMILES | O=c1nccc(C2CCCN(S(=O)(=O)c3ccc(F)c(F)c3)C2)[nH]1 |
| InChI | InChI=1S/C15H15F2N3O3S/c16-12-4-3-11(8-13(12)17)24(22,23)20-7-1-2-10(9-20)14-5-6-18-15(21)19-14/h3-6,8,10H,1-2,7,9H2,(H,18,19,21) |
| InChIKey | JSLWMAOKRGWWKX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |