C13H17N5O3S — CID 124983935
6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one (PubChem CID 124983935) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 124983935 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]-1H-pyrimidin-2-one |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC[C@@H](c3ccnc(=O)[nH]3)C2)c1 |
| InChI | InChI=1S/C13H17N5O3S/c1-17-8-12(15-9-17)22(20,21)18-6-2-3-10(7-18)11-4-5-14-13(19)16-11/h4-5,8-10H,2-3,6-7H2,1H3,(H,14,16,19)/t10-/m1/s1 |
| InChIKey | NHGFQEMDMYWJIG-SNVBAGLBSA-N |
| XLogP | 0.07 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |