C20H21FN4O2S — CID 95810657
2-(2-fluorophenyl)-6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine (PubChem CID 95810657) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine.
| Compound Name | 2-(2-fluorophenyl)-6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95810657 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-(2-fluorophenyl)-6-[(3R)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC[C@@H](c3cccc(-c4ccccc4F)n3)C2)c1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-24-13-20(22-14-24)28(26,27)25-11-5-6-15(12-25)18-9-4-10-19(23-18)16-7-2-3-8-17(16)21/h2-4,7-10,13-15H,5-6,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | GQNALGYNIXPLBB-OAHLLOKOSA-N |
| XLogP | 3.19 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |