C20H23N5O3S — CID 110255183
2-(2-methoxyphenyl)-3-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyrazine (PubChem CID 110255183) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-3-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyrazine.
| Compound Name | 2-(2-methoxyphenyl)-3-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyrazine |
|---|---|
| PubChem CID | 110255183 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-(2-methoxyphenyl)-3-[1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyrazine |
| SMILES | COc1ccccc1-c1nccnc1C1CCCN(S(=O)(=O)c2cn(C)cn2)C1 |
| InChI | InChI=1S/C20H23N5O3S/c1-24-13-18(23-14-24)29(26,27)25-11-5-6-15(12-25)19-20(22-10-9-21-19)16-7-3-4-8-17(16)28-2/h3-4,7-10,13-15H,5-6,11-12H2,1-2H3 |
| InChIKey | UNASPXNBXJBAIB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |