C20H21ClN4O2S — CID 95810668
2-(3-chlorophenyl)-6-[(3S)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine (PubChem CID 95810668) has the molecular formula C20H21ClN4O2S and a molecular weight of 416.93 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-6-[(3S)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine.
| Compound Name | 2-(3-chlorophenyl)-6-[(3S)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine |
|---|---|
| PubChem CID | 95810668 |
| Molecular Formula | C20H21ClN4O2S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 2-(3-chlorophenyl)-6-[(3S)-1-(1-methylimidazol-4-yl)sulfonylpiperidin-3-yl]pyridine |
| SMILES | Cn1cnc(S(=O)(=O)N2CCC[C@H](c3cccc(-c4cccc(Cl)c4)n3)C2)c1 |
| InChI | InChI=1S/C20H21ClN4O2S/c1-24-13-20(22-14-24)28(26,27)25-10-4-6-16(12-25)19-9-3-8-18(23-19)15-5-2-7-17(21)11-15/h2-3,5,7-9,11,13-14,16H,4,6,10,12H2,1H3/t16-/m0/s1 |
| InChIKey | NTCUIDMZYMQQGW-INIZCTEOSA-N |
| XLogP | 3.70 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |