C16H16FN3O2 — CID 125019436
6-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]-1H-pyrimidin-2-one (PubChem CID 125019436) has the molecular formula C16H16FN3O2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 6-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 125019436 |
| Molecular Formula | C16H16FN3O2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 6-[(3R)-1-(2-fluorobenzoyl)piperidin-3-yl]-1H-pyrimidin-2-one |
| SMILES | O=C(c1ccccc1F)N1CCC[C@@H](c2ccnc(=O)[nH]2)C1 |
| InChI | InChI=1S/C16H16FN3O2/c17-13-6-2-1-5-12(13)15(21)20-9-3-4-11(10-20)14-7-8-18-16(22)19-14/h1-2,5-8,11H,3-4,9-10H2,(H,18,19,22)/t11-/m1/s1 |
| InChIKey | XVXPKBOECHMINX-LLVKDONJSA-N |
| XLogP | 1.93 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |