C17H23N5O2 — CID 125005483
6-[(3R)-1-(5-tert-butyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-2-one (PubChem CID 125005483) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 6-[(3R)-1-(5-tert-butyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-2-one.
| Compound Name | 6-[(3R)-1-(5-tert-butyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 125005483 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 6-[(3R)-1-(5-tert-butyl-1H-pyrazole-3-carbonyl)piperidin-3-yl]-1H-pyrimidin-2-one |
| SMILES | CC(C)(C)c1cc(C(=O)N2CCC[C@@H](c3ccnc(=O)[nH]3)C2)n[nH]1 |
| InChI | InChI=1S/C17H23N5O2/c1-17(2,3)14-9-13(20-21-14)15(23)22-8-4-5-11(10-22)12-6-7-18-16(24)19-12/h6-7,9,11H,4-5,8,10H2,1-3H3,(H,20,21)(H,18,19,24)/t11-/m1/s1 |
| InChIKey | TZRLECOYWYQZAF-LLVKDONJSA-N |
| XLogP | 1.81 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |