C20H21FN2O2S — CID 113088702
2-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-5-methyl-1H-indole (PubChem CID 113088702) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-5-methyl-1H-indole.
| Compound Name | 2-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-5-methyl-1H-indole |
|---|---|
| PubChem CID | 113088702 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-[1-(4-fluorophenyl)sulfonylpiperidin-3-yl]-5-methyl-1H-indole |
| SMILES | Cc1ccc2[nH]c(C3CCCN(S(=O)(=O)c4ccc(F)cc4)C3)cc2c1 |
| InChI | InChI=1S/C20H21FN2O2S/c1-14-4-9-19-16(11-14)12-20(22-19)15-3-2-10-23(13-15)26(24,25)18-7-5-17(21)6-8-18/h4-9,11-12,15,22H,2-3,10,13H2,1H3 |
| InChIKey | BZIFXKJZORTXCY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |