C21H23N3O3S — CID 51728621
N-[4-[(3R)-3-(1H-indol-2-yl)piperidin-1-yl]sulfonylphenyl]acetamide (PubChem CID 51728621) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[4-[(3R)-3-(1H-indol-2-yl)piperidin-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[(3R)-3-(1H-indol-2-yl)piperidin-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 51728621 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-[4-[(3R)-3-(1H-indol-2-yl)piperidin-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CCC[C@@H](c3cc4ccccc4[nH]3)C2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-15(25)22-18-8-10-19(11-9-18)28(26,27)24-12-4-6-17(14-24)21-13-16-5-2-3-7-20(16)23-21/h2-3,5,7-11,13,17,23H,4,6,12,14H2,1H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | ODPORAAOEZVTCU-QGZVFWFLSA-N |
| XLogP | 3.69 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |