C21H20F2N2O — CID 113088680
(3,4-difluorophenyl)-[3-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone (PubChem CID 113088680) has the molecular formula C21H20F2N2O and a molecular weight of 354.40 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[3-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[3-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113088680 |
| Molecular Formula | C21H20F2N2O |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3,4-difluorophenyl)-[3-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc2[nH]c(C3CCCN(C(=O)c4ccc(F)c(F)c4)C3)cc2c1 |
| InChI | InChI=1S/C21H20F2N2O/c1-13-4-7-19-16(9-13)11-20(24-19)15-3-2-8-25(12-15)21(26)14-5-6-17(22)18(23)10-14/h4-7,9-11,15,24H,2-3,8,12H2,1H3 |
| InChIKey | GKORELOSOQKJKN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |