C22H22N2O3 — CID 113088055
1,3-benzodioxol-5-yl-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone (PubChem CID 113088055) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 113088055 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(5-methyl-1H-indol-2-yl)piperidin-1-yl]methanone |
| SMILES | Cc1ccc2[nH]c(C3CCN(C(=O)c4ccc5c(c4)OCO5)CC3)cc2c1 |
| InChI | InChI=1S/C22H22N2O3/c1-14-2-4-18-17(10-14)11-19(23-18)15-6-8-24(9-7-15)22(25)16-3-5-20-21(12-16)27-13-26-20/h2-5,10-12,15,23H,6-9,13H2,1H3 |
| InChIKey | IMOQQQHKROSKGE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |