C15H20N2O3 — CID 110473360
1,3-benzodioxol-5-yl-[4-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 110473360) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-[4-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | 1,3-benzodioxol-5-yl-[4-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 110473360 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl-[4-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H20N2O3/c1-16(2)12-5-7-17(8-6-12)15(18)11-3-4-13-14(9-11)20-10-19-13/h3-4,9,12H,5-8,10H2,1-2H3 |
| InChIKey | KKBVDXVBMFPNMM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |