C14H18N2O4 — CID 39377171
[4-(aminooxymethyl)piperidin-1-yl]-(1,3-benzodioxol-5-yl)methanone (PubChem CID 39377171) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [4-(aminooxymethyl)piperidin-1-yl]-(1,3-benzodioxol-5-yl)methanone.
| Compound Name | [4-(aminooxymethyl)piperidin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
|---|---|
| PubChem CID | 39377171 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [4-(aminooxymethyl)piperidin-1-yl]-(1,3-benzodioxol-5-yl)methanone |
| SMILES | NOCC1CCN(C(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C14H18N2O4/c15-20-8-10-3-5-16(6-4-10)14(17)11-1-2-12-13(7-11)19-9-18-12/h1-2,7,10H,3-6,8-9,15H2 |
| InChIKey | OYBGAXJICMJFBK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|