C16H17NO6 — CID 84581895
methyl 1-(1,3-benzodioxole-5-carbonyl)-5-oxoazepane-4-carboxylate (PubChem CID 84581895) has the molecular formula C16H17NO6 and a molecular weight of 319.31 g/mol. Its IUPAC name is methyl 1-(1,3-benzodioxole-5-carbonyl)-5-oxoazepane-4-carboxylate.
| Compound Name | methyl 1-(1,3-benzodioxole-5-carbonyl)-5-oxoazepane-4-carboxylate |
|---|---|
| PubChem CID | 84581895 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | methyl 1-(1,3-benzodioxole-5-carbonyl)-5-oxoazepane-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2ccc3c(c2)OCO3)CCC1=O |
| InChI | InChI=1S/C16H17NO6/c1-21-16(20)11-4-6-17(7-5-12(11)18)15(19)10-2-3-13-14(8-10)23-9-22-13/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | YSBACDQTSXUWNR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|