C15H16Cl2N2O4 — CID 108566835
N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-2,2-dichloroacetamide (PubChem CID 108566835) has the molecular formula C15H16Cl2N2O4 and a molecular weight of 359.21 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-2,2-dichloroacetamide.
| Compound Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 108566835 |
| Molecular Formula | C15H16Cl2N2O4 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-2,2-dichloroacetamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc3c(c2)OCO3)CC1)C(Cl)Cl |
| InChI | InChI=1S/C15H16Cl2N2O4/c16-13(17)14(20)18-10-3-5-19(6-4-10)15(21)9-1-2-11-12(7-9)23-8-22-11/h1-2,7,10,13H,3-6,8H2,(H,18,20) |
| InChIKey | ZOKRDWUFHYAJJW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|