C18H18N4O4 — CID 108557429
N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]pyrazine-2-carboxamide (PubChem CID 108557429) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]pyrazine-2-carboxamide.
| Compound Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 108557429 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc3c(c2)OCO3)CC1)c1cnccn1 |
| InChI | InChI=1S/C18H18N4O4/c23-17(14-10-19-5-6-20-14)21-13-3-7-22(8-4-13)18(24)12-1-2-15-16(9-12)26-11-25-15/h1-2,5-6,9-10,13H,3-4,7-8,11H2,(H,21,23) |
| InChIKey | JGPYSHKMASFRNV-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |