C22H24N2O5 — CID 108551927
N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-4-ethoxybenzamide (PubChem CID 108551927) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-4-ethoxybenzamide.
| Compound Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 108551927 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[1-(1,3-benzodioxole-5-carbonyl)piperidin-4-yl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCN(C(=O)c3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-2-27-18-6-3-15(4-7-18)21(25)23-17-9-11-24(12-10-17)22(26)16-5-8-19-20(13-16)29-14-28-19/h3-8,13,17H,2,9-12,14H2,1H3,(H,23,25) |
| InChIKey | BBRNKHGRQAYIRR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |